About (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine
(E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine (PubChem CID 88596252) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine.
Molecular Properties
| Compound Name | (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine |
| PubChem CID | 88596252 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine |
| SMILES | CC#CO/N=C1\CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C13H19NO/c1-5-8-15-14-11-9-10-6-7-13(11,4)12(10,2)3/h10H,6-7,9H2,1-4H3/b14-11+ |
| InChIKey | USSSRNXUEUGRJQ-SDNWHVSQSA-N |
| XLogP | 3.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine?
The IUPAC name of (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine (CID 88596252) is (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine.
What is the SMILES notation for (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine?
The canonical SMILES for (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine is CC#CO/N=C1\CC2CCC1(C)C2(C)C.
What is the InChIKey of (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine?
The InChIKey is USSSRNXUEUGRJQ-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H19NO/c1-5-8-15-14-11-9-10-6-7-13(11,4)12(10,2)3/h10H,6-7,9H2,1-4H3/b14-11+.
What are the key properties of (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine?
(E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine has a molecular weight of 205.30 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,7,7-trimethyl-N-prop-1-ynoxybicyclo[2.2.1]heptan-2-imine is sourced from PubChem (CID 88596252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).