About bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol
bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol (PubChem CID 88596466) has the molecular formula C3H13NO7P2+2
and a molecular weight of 237.08 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol |
| PubChem CID | 88596466 |
| Molecular Formula | C3H13NO7P2+2 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol |
| SMILES | CNCCO.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C3H9NO.2HO3P/c1-4-2-3-5;2*1-4(2)3/h4-5H,2-3H2,1H3;2*(H-,1,2,3)/p+2 |
| InChIKey | TXAGGUXQBKUZOU-UHFFFAOYSA-P |
| XLogP | -1.55 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol (CID 88596466) is bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol is CNCCO.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol?
The InChIKey is TXAGGUXQBKUZOU-UHFFFAOYSA-P. The full InChI is InChI=1S/C3H9NO.2HO3P/c1-4-2-3-5;2*1-4(2)3/h4-5H,2-3H2,1H3;2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol?
bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol has a molecular weight of 237.08 g/mol, XLogP of -1.55, 2 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);2-(methylamino)ethanol is sourced from PubChem (CID 88596466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).