About (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate
(propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate (PubChem CID 88596489) has the molecular formula C11H12ClNO3
and a molecular weight of 241.67 g/mol. Its IUPAC name is (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate |
| PubChem CID | 88596489 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate |
| SMILES | CC(C)=NOC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO3/c1-8(2)13-16-11(14)7-15-10-5-3-4-9(12)6-10/h3-6H,7H2,1-2H3 |
| InChIKey | MJJIMWKFODEKMR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate?
The IUPAC name of (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate (CID 88596489) is (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate.
What is the SMILES notation for (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate?
The canonical SMILES for (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate is CC(C)=NOC(=O)COc1cccc(Cl)c1.
What is the InChIKey of (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate?
The InChIKey is MJJIMWKFODEKMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO3/c1-8(2)13-16-11(14)7-15-10-5-3-4-9(12)6-10/h3-6H,7H2,1-2H3.
What are the key properties of (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate?
(propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate has a molecular weight of 241.67 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) 2-(3-chlorophenoxy)acetate is sourced from PubChem (CID 88596489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).