About ethanol;prop-2-enyl 2,3-dihydroxypropanoate
ethanol;prop-2-enyl 2,3-dihydroxypropanoate (PubChem CID 88596690) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is ethanol;prop-2-enyl 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | ethanol;prop-2-enyl 2,3-dihydroxypropanoate |
| PubChem CID | 88596690 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | ethanol;prop-2-enyl 2,3-dihydroxypropanoate |
| SMILES | C=CCOC(=O)C(O)CO.CCO |
| InChI | InChI=1S/C6H10O4.C2H6O/c1-2-3-10-6(9)5(8)4-7;1-2-3/h2,5,7-8H,1,3-4H2;3H,2H2,1H3 |
| InChIKey | RCAGFPVJNVZGMN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethanol;prop-2-enyl 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;prop-2-enyl 2,3-dihydroxypropanoate?
The IUPAC name of ethanol;prop-2-enyl 2,3-dihydroxypropanoate (CID 88596690) is ethanol;prop-2-enyl 2,3-dihydroxypropanoate.
What is the SMILES notation for ethanol;prop-2-enyl 2,3-dihydroxypropanoate?
The canonical SMILES for ethanol;prop-2-enyl 2,3-dihydroxypropanoate is C=CCOC(=O)C(O)CO.CCO.
What is the InChIKey of ethanol;prop-2-enyl 2,3-dihydroxypropanoate?
The InChIKey is RCAGFPVJNVZGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C2H6O/c1-2-3-10-6(9)5(8)4-7;1-2-3/h2,5,7-8H,1,3-4H2;3H,2H2,1H3.
What are the key properties of ethanol;prop-2-enyl 2,3-dihydroxypropanoate?
ethanol;prop-2-enyl 2,3-dihydroxypropanoate has a molecular weight of 192.21 g/mol, XLogP of -0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;prop-2-enyl 2,3-dihydroxypropanoate is sourced from PubChem (CID 88596690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).