C22H20F5NO — CID 88596812
4-[4-(4-hydroxyphenyl)phenyl]-4-methyl-1-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-carbonitrile (PubChem CID 88596812) has the molecular formula C22H20F5NO and a molecular weight of 409.40 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)phenyl]-4-methyl-1-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(4-hydroxyphenyl)phenyl]-4-methyl-1-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 88596812 |
| Molecular Formula | C22H20F5NO |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)phenyl]-4-methyl-1-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-carbonitrile |
| SMILES | CC1(c2ccc(-c3ccc(O)cc3)cc2)CCC(C#N)(C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H20F5NO/c1-19(10-12-20(14-28,13-11-19)21(23,24)22(25,26)27)17-6-2-15(3-7-17)16-4-8-18(29)9-5-16/h2-9,29H,10-13H2,1H3 |
| InChIKey | VZXUKAZAFPGKHJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|