C15H18O5 — CID 88596977
1,9-dimethyl-10-(2-methylprop-2-enyl)-3,5,7-trioxatricyclo[7.2.1.02,8]dodec-2(8)-ene-4,6-dione (PubChem CID 88596977) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 1,9-dimethyl-10-(2-methylprop-2-enyl)-3,5,7-trioxatricyclo[7.2.1.02,8]dodec-2(8)-ene-4,6-dione.
| Compound Name | 1,9-dimethyl-10-(2-methylprop-2-enyl)-3,5,7-trioxatricyclo[7.2.1.02,8]dodec-2(8)-ene-4,6-dione |
|---|---|
| PubChem CID | 88596977 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1,9-dimethyl-10-(2-methylprop-2-enyl)-3,5,7-trioxatricyclo[7.2.1.02,8]dodec-2(8)-ene-4,6-dione |
| SMILES | C=C(C)CC1CC2(C)CC1(C)C1=C2OC(=O)OC(=O)O1 |
| InChI | InChI=1S/C15H18O5/c1-8(2)5-9-6-14(3)7-15(9,4)11-10(14)18-12(16)20-13(17)19-11/h9H,1,5-7H2,2-4H3 |
| InChIKey | OYKVZHVZXFHKGU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|