About 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine
2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine (PubChem CID 88597447) has the molecular formula C7H17Cl3N2
and a molecular weight of 235.59 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine.
Molecular Properties
| Compound Name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine |
| PubChem CID | 88597447 |
| Molecular Formula | C7H17Cl3N2 |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine |
| SMILES | CCNCl.CN(CCCl)CCCl |
| InChI | InChI=1S/C5H11Cl2N.C2H6ClN/c1-8(4-2-6)5-3-7;1-2-4-3/h2-5H2,1H3;4H,2H2,1H3 |
| InChIKey | UGZAWNJOCQUWCL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine?
The IUPAC name of 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine (CID 88597447) is 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine.
What is the SMILES notation for 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine?
The canonical SMILES for 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine is CCNCl.CN(CCCl)CCCl.
What is the InChIKey of 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine?
The InChIKey is UGZAWNJOCQUWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Cl2N.C2H6ClN/c1-8(4-2-6)5-3-7;1-2-4-3/h2-5H2,1H3;4H,2H2,1H3.
What are the key properties of 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine?
2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine has a molecular weight of 235.59 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2-chloroethyl)-N-methylethanamine;N-chloroethanamine is sourced from PubChem (CID 88597447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).