C9H11NO4S2 — CID 88597798
(2R,3R,5R,6R)-6-(1-hydroxyethyl)-3-methanethioyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88597798) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2R,3R,5R,6R)-6-(1-hydroxyethyl)-3-methanethioyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,3R,5R,6R)-6-(1-hydroxyethyl)-3-methanethioyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88597798 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | (2R,3R,5R,6R)-6-(1-hydroxyethyl)-3-methanethioyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(O)[C@@H]1C(=O)N2[C@@H]1S[C@@H](C=S)[C@H]2C(=O)O |
| InChI | InChI=1S/C9H11NO4S2/c1-3(11)5-7(12)10-6(9(13)14)4(2-15)16-8(5)10/h2-6,8,11H,1H3,(H,13,14)/t3?,4-,5+,6-,8+/m0/s1 |
| InChIKey | YQBNOLQAEYLQLQ-YRSMSZJHSA-N |
| XLogP | -0.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|