C19H20BrNO6S — CID 88598118
prop-2-enyl (2S,5R,6S)-6-bromo-6-[1-hydroxy-1-(3-hydroxyphenyl)-2-oxoethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88598118) has the molecular formula C19H20BrNO6S and a molecular weight of 470.34 g/mol. Its IUPAC name is prop-2-enyl (2S,5R,6S)-6-bromo-6-[1-hydroxy-1-(3-hydroxyphenyl)-2-oxoethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,5R,6S)-6-bromo-6-[1-hydroxy-1-(3-hydroxyphenyl)-2-oxoethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88598118 |
| Molecular Formula | C19H20BrNO6S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | prop-2-enyl (2S,5R,6S)-6-bromo-6-[1-hydroxy-1-(3-hydroxyphenyl)-2-oxoethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1N2C(=O)[C@@](Br)(C(O)(C=O)c3cccc(O)c3)[C@H]2SC1(C)C |
| InChI | InChI=1S/C19H20BrNO6S/c1-4-8-27-14(24)13-17(2,3)28-16-19(20,15(25)21(13)16)18(26,10-22)11-6-5-7-12(23)9-11/h4-7,9-10,13,16,23,26H,1,8H2,2-3H3/t13-,16+,18?,19-/m0/s1 |
| InChIKey | MSQGETFGQDSGMR-AYVMVTTMSA-N |
| XLogP | 1.70 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|