About 2H-indeno[1,2-g][1]benzofuran
2H-indeno[1,2-g][1]benzofuran (PubChem CID 88598125) has the molecular formula C15H10O
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2H-indeno[1,2-g][1]benzofuran.
Molecular Properties
| Compound Name | 2H-indeno[1,2-g][1]benzofuran |
| PubChem CID | 88598125 |
| Molecular Formula | C15H10O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2H-indeno[1,2-g][1]benzofuran |
| SMILES | C1=c2ccc3c(c2OC1)C=c1ccccc1=3 |
| InChI | InChI=1S/C15H10O/c1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14/h1-7,9H,8H2 |
| InChIKey | UTDCGTAAWGJIOW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-indeno[1,2-g][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indeno[1,2-g][1]benzofuran?
The IUPAC name of 2H-indeno[1,2-g][1]benzofuran (CID 88598125) is 2H-indeno[1,2-g][1]benzofuran.
What is the SMILES notation for 2H-indeno[1,2-g][1]benzofuran?
The canonical SMILES for 2H-indeno[1,2-g][1]benzofuran is C1=c2ccc3c(c2OC1)C=c1ccccc1=3.
What is the InChIKey of 2H-indeno[1,2-g][1]benzofuran?
The InChIKey is UTDCGTAAWGJIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O/c1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14/h1-7,9H,8H2.
What are the key properties of 2H-indeno[1,2-g][1]benzofuran?
2H-indeno[1,2-g][1]benzofuran has a molecular weight of 206.24 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indeno[1,2-g][1]benzofuran is sourced from PubChem (CID 88598125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).