About 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate
2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate (PubChem CID 88598612) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate |
| PubChem CID | 88598612 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate |
| SMILES | C=CC(C)(C)OOOC(=O)C1C=CCCC1 |
| InChI | InChI=1S/C12H18O4/c1-4-12(2,3)15-16-14-11(13)10-8-6-5-7-9-10/h4,6,8,10H,1,5,7,9H2,2-3H3 |
| InChIKey | ILOKFRAQBQEFCW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate?
The IUPAC name of 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate (CID 88598612) is 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate.
What is the SMILES notation for 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate?
The canonical SMILES for 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate is C=CC(C)(C)OOOC(=O)C1C=CCCC1.
What is the InChIKey of 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate?
The InChIKey is ILOKFRAQBQEFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-4-12(2,3)15-16-14-11(13)10-8-6-5-7-9-10/h4,6,8,10H,1,5,7,9H2,2-3H3.
What are the key properties of 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate?
2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate has a molecular weight of 226.27 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yloxy cyclohex-2-ene-1-carboperoxoate is sourced from PubChem (CID 88598612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).