C15H12Cl2F3N3O4 — CID 88598718
2,2-dichloro-N-[2-(trifluoromethyl)phenyl]acetamide;N-(1,3-oxazol-2-yl)-3-oxopropanamide (PubChem CID 88598718) has the molecular formula C15H12Cl2F3N3O4 and a molecular weight of 426.18 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(trifluoromethyl)phenyl]acetamide;N-(1,3-oxazol-2-yl)-3-oxopropanamide.
| Compound Name | 2,2-dichloro-N-[2-(trifluoromethyl)phenyl]acetamide;N-(1,3-oxazol-2-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 88598718 |
| Molecular Formula | C15H12Cl2F3N3O4 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2,2-dichloro-N-[2-(trifluoromethyl)phenyl]acetamide;N-(1,3-oxazol-2-yl)-3-oxopropanamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C(Cl)Cl.O=CCC(=O)Nc1ncco1 |
| InChI | InChI=1S/C9H6Cl2F3NO.C6H6N2O3/c10-7(11)8(16)15-6-4-2-1-3-5(6)9(12,13)14;9-3-1-5(10)8-6-7-2-4-11-6/h1-4,7H,(H,15,16);2-4H,1H2,(H,7,8,10) |
| InChIKey | MJWMZEBTWYUDFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|