C24H28N2O2 — CID 88599108
10,18-ditert-butyl-2,6-dioxa-13,15-diazatetracyclo[14.4.0.03,5.07,12]icosa-1(16),7(12),8,10,13,14,17,19-octaene (PubChem CID 88599108) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 10,18-ditert-butyl-2,6-dioxa-13,15-diazatetracyclo[14.4.0.03,5.07,12]icosa-1(16),7(12),8,10,13,14,17,19-octaene.
| Compound Name | 10,18-ditert-butyl-2,6-dioxa-13,15-diazatetracyclo[14.4.0.03,5.07,12]icosa-1(16),7(12),8,10,13,14,17,19-octaene |
|---|---|
| PubChem CID | 88599108 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 10,18-ditert-butyl-2,6-dioxa-13,15-diazatetracyclo[14.4.0.03,5.07,12]icosa-1(16),7(12),8,10,13,14,17,19-octaene |
| SMILES | CC(C)(C)c1ccc2c(c1)N=C=Nc1cc(C(C)(C)C)ccc1OC1CC1O2 |
| InChI | InChI=1S/C24H28N2O2/c1-23(2,3)15-7-9-19-17(11-15)25-14-26-18-12-16(24(4,5)6)8-10-20(18)28-22-13-21(22)27-19/h7-12,21-22H,13H2,1-6H3 |
| InChIKey | PTRZQIKURDDJDK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |