C30H38O6SSi — CID 88599316
[(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 88599316) has the molecular formula C30H38O6SSi and a molecular weight of 554.78 g/mol. Its IUPAC name is [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88599316 |
| Molecular Formula | C30H38O6SSi |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C30H38O6SSi/c1-23-16-18-26(19-17-23)37(31,32)34-22-25-20-24(21-29(33-5)35-25)36-38(30(2,3)4,27-12-8-6-9-13-27)28-14-10-7-11-15-28/h6-19,24-25,29H,20-22H2,1-5H3/t24-,25+,29-/m1/s1 |
| InChIKey | VCYOADKYHAVPEB-BEYSDYMESA-N |
| XLogP | 4.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|