C13H12N2O2S2 — CID 88599459
1-[(5,6-dimethyl-1,3-benzothiazol-2-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 88599459) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-[(5,6-dimethyl-1,3-benzothiazol-2-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(5,6-dimethyl-1,3-benzothiazol-2-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 88599459 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-[(5,6-dimethyl-1,3-benzothiazol-2-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc2nc(SN3C(=O)CCC3=O)sc2cc1C |
| InChI | InChI=1S/C13H12N2O2S2/c1-7-5-9-10(6-8(7)2)18-13(14-9)19-15-11(16)3-4-12(15)17/h5-6H,3-4H2,1-2H3 |
| InChIKey | IBGZQXNBRODVEG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|