About diethynyl 2-ethenylpropanedioate
diethynyl 2-ethenylpropanedioate (PubChem CID 88599686) has the molecular formula C9H6O4
and a molecular weight of 178.14 g/mol. Its IUPAC name is diethynyl 2-ethenylpropanedioate.
Molecular Properties
| Compound Name | diethynyl 2-ethenylpropanedioate |
| PubChem CID | 88599686 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | diethynyl 2-ethenylpropanedioate |
| SMILES | C#COC(=O)C(C=C)C(=O)OC#C |
| InChI | InChI=1S/C9H6O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h2-4,7H,1H2 |
| InChIKey | LDHAINLVNJGXFT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze diethynyl 2-ethenylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethynyl 2-ethenylpropanedioate?
The IUPAC name of diethynyl 2-ethenylpropanedioate (CID 88599686) is diethynyl 2-ethenylpropanedioate.
What is the SMILES notation for diethynyl 2-ethenylpropanedioate?
The canonical SMILES for diethynyl 2-ethenylpropanedioate is C#COC(=O)C(C=C)C(=O)OC#C.
What is the InChIKey of diethynyl 2-ethenylpropanedioate?
The InChIKey is LDHAINLVNJGXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h2-4,7H,1H2.
What are the key properties of diethynyl 2-ethenylpropanedioate?
diethynyl 2-ethenylpropanedioate has a molecular weight of 178.14 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethynyl 2-ethenylpropanedioate is sourced from PubChem (CID 88599686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).