About sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide
sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide (PubChem CID 88599824) has the molecular formula C13H17ClN3NaO5S
and a molecular weight of 385.81 g/mol. Its IUPAC name is sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide |
| PubChem CID | 88599824 |
| Molecular Formula | C13H17ClN3NaO5S |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.NC(=O)CN1CC(O)CC1=O.[Na+] |
| InChI | InChI=1S/C7H7ClNO2S.C6H10N2O3.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;7-5(10)3-8-2-4(9)1-6(8)11;/h2-5H,1H3;4,9H,1-3H2,(H2,7,10);/q-1;;+1 |
| InChIKey | RPVAQIUNOSBFTR-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide?
The IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide (CID 88599824) is sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide.
What is the SMILES notation for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide?
The canonical SMILES for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide is Cc1ccc(S(=O)(=O)[N-]Cl)cc1.NC(=O)CN1CC(O)CC1=O.[Na+].
What is the InChIKey of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide?
The InChIKey is RPVAQIUNOSBFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClNO2S.C6H10N2O3.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;7-5(10)3-8-2-4(9)1-6(8)11;/h2-5H,1H3;4,9H,1-3H2,(H2,7,10);/q-1;;+1.
What are the key properties of sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide?
sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide has a molecular weight of 385.81 g/mol, XLogP of -2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloro-(4-methylphenyl)sulfonylazanide;2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide is sourced from PubChem (CID 88599824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).