C22H29N6O5S2+ — CID 88600778
(6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-[(1-methylpiperidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88600778) has the molecular formula C22H29N6O5S2+ and a molecular weight of 521.65 g/mol. Its IUPAC name is (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-[(1-methylpiperidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-[(1-methylpiperidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88600778 |
| Molecular Formula | C22H29N6O5S2+ |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-3-[(1-methylpiperidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(C[N+]3(C)CCCCC3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C22H28N6O5S2/c1-3-9-33-26-15(14-12-35-22(23)24-14)18(29)25-16-19(30)27-17(21(31)32)13(11-34-20(16)27)10-28(2)7-5-4-6-8-28/h3,12,16,20H,1,4-11H2,2H3,(H3-,23,24,25,29,31,32)/p+1/b26-15-/t16?,20-/m0/s1 |
| InChIKey | UKDAJHNUHNJGEK-OBJGNAKHSA-O |
| XLogP | 1.00 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|