About 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one
4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 88601089) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 88601089 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1=CC(=S(=O)=O)C(C2=NNC(=O)CC2C)C=C1 |
| InChI | InChI=1S/C12H14N2O3S/c1-7-3-4-9(10(5-7)18(16)17)12-8(2)6-11(15)13-14-12/h3-5,8-9H,6H2,1-2H3,(H,13,15) |
| InChIKey | PASNYEOFWNRQFK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one (CID 88601089) is 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one is CC1=CC(=S(=O)=O)C(C2=NNC(=O)CC2C)C=C1.
What is the InChIKey of 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is PASNYEOFWNRQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c1-7-3-4-9(10(5-7)18(16)17)12-8(2)6-11(15)13-14-12/h3-5,8-9H,6H2,1-2H3,(H,13,15).
What are the key properties of 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one?
4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 266.32 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(4-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 88601089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).