C54H80N12O2 — CID 88601398
4-[3-[3-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]propyl]-2,6-dimethylphenol (PubChem CID 88601398) has the molecular formula C54H80N12O2 and a molecular weight of 929.32 g/mol. Its IUPAC name is 4-[3-[3-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]propyl]-2,6-dimethylphenol.
| Compound Name | 4-[3-[3-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]propyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 88601398 |
| Molecular Formula | C54H80N12O2 |
| Molecular Weight | 929.32 g/mol |
| Exact Mass | 928.65 |
| IUPAC Name | 4-[3-[3-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)piperazin-1-yl]propyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(CCCN2CCNC(c3cc(N4CCCC4)nc(N4CCCC4)n3)C2)cc(C)c1O.Cc1cc(CCCN2CCNC(c3cc(N4CCCC4)nc(N4CCCC4)n3)C2)cc(C)c1O |
| InChI | InChI=1S/2C27H40N6O/c2*1-20-16-22(17-21(2)26(20)34)8-7-10-31-15-9-28-24(19-31)23-18-25(32-11-3-4-12-32)30-27(29-23)33-13-5-6-14-33/h2*16-18,24,28,34H,3-15,19H2,1-2H3 |
| InChIKey | CLSAROWPLOGMAO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.32 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |