C10H3BF6O4 — CID 88602119
2-[3,5-bis(trifluoromethyl)phenyl]-1,3,2-dioxaborolane-4,5-dione (PubChem CID 88602119) has the molecular formula C10H3BF6O4 and a molecular weight of 311.93 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-1,3,2-dioxaborolane-4,5-dione.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1,3,2-dioxaborolane-4,5-dione |
|---|---|
| PubChem CID | 88602119 |
| Molecular Formula | C10H3BF6O4 |
| Molecular Weight | 311.93 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1,3,2-dioxaborolane-4,5-dione |
| SMILES | O=C1OB(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC1=O |
| InChI | InChI=1S/C10H3BF6O4/c12-9(13,14)4-1-5(10(15,16)17)3-6(2-4)11-20-7(18)8(19)21-11/h1-3H |
| InChIKey | XACSAZARFIZPET-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.93 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|