C45H47IO9 — CID 88602141
8-iodo-4-methyl-7-(2-methylbut-3-en-2-yloxy)chromen-2-one;4-methyl-7-propoxychromen-2-one;7-oct-2-ynoxychromen-2-one (PubChem CID 88602141) has the molecular formula C45H47IO9 and a molecular weight of 858.77 g/mol. Its IUPAC name is 8-iodo-4-methyl-7-(2-methylbut-3-en-2-yloxy)chromen-2-one;4-methyl-7-propoxychromen-2-one;7-oct-2-ynoxychromen-2-one.
| Compound Name | 8-iodo-4-methyl-7-(2-methylbut-3-en-2-yloxy)chromen-2-one;4-methyl-7-propoxychromen-2-one;7-oct-2-ynoxychromen-2-one |
|---|---|
| PubChem CID | 88602141 |
| Molecular Formula | C45H47IO9 |
| Molecular Weight | 858.77 g/mol |
| Exact Mass | 858.23 |
| IUPAC Name | 8-iodo-4-methyl-7-(2-methylbut-3-en-2-yloxy)chromen-2-one;4-methyl-7-propoxychromen-2-one;7-oct-2-ynoxychromen-2-one |
| SMILES | C=CC(C)(C)Oc1ccc2c(C)cc(=O)oc2c1I.CCCCCC#CCOc1ccc2ccc(=O)oc2c1.CCCOc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H18O3.C15H15IO3.C13H14O3/c1-2-3-4-5-6-7-12-19-15-10-8-14-9-11-17(18)20-16(14)13-15;1-5-15(3,4)19-11-7-6-10-9(2)8-12(17)18-14(10)13(11)16;1-3-6-15-10-4-5-11-9(2)7-13(14)16-12(11)8-10/h8-11,13H,2-5,12H2,1H3;5-8H,1H2,2-4H3;4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | LKGVCHQYESKNGD-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 118.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.77 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|