C9H17BN2O2 — CID 88602147
(Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine (PubChem CID 88602147) has the molecular formula C9H17BN2O2 and a molecular weight of 196.06 g/mol. Its IUPAC name is (Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 88602147 |
| Molecular Formula | C9H17BN2O2 |
| Molecular Weight | 196.06 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C9H17BN2O2/c1-8(2)9(3,4)14-10(13-8)7(5-11)6-12/h5-6,11H,12H2,1-4H3/b7-6+,11-5+ |
| InChIKey | PFVCCMOOCGLRPV-YDRCSAEOSA-N |
| XLogP | 1.11 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.06 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|