C10H9N3S — CID 88602223
2-(4-methyl-1,3,5-triazin-2-yl)cyclohexa-2,4-diene-1-thione (PubChem CID 88602223) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is 2-(4-methyl-1,3,5-triazin-2-yl)cyclohexa-2,4-diene-1-thione.
| Compound Name | 2-(4-methyl-1,3,5-triazin-2-yl)cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 88602223 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-(4-methyl-1,3,5-triazin-2-yl)cyclohexa-2,4-diene-1-thione |
| SMILES | Cc1ncnc(C2=CC=CCC2=S)n1 |
| InChI | InChI=1S/C10H9N3S/c1-7-11-6-12-10(13-7)8-4-2-3-5-9(8)14/h2-4,6H,5H2,1H3 |
| InChIKey | KWTVVSBYBJDGMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|