C19H18F7N7O3 — CID 88602362
3-amino-N-[6-[(3R,6R)-5-amino-3,6-dimethyl-6-(trifluoromethyl)-2H-1,4-oxazin-3-yl]-5-fluoro-2-pyridinyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 88602362) has the molecular formula C19H18F7N7O3 and a molecular weight of 525.39 g/mol. Its IUPAC name is 3-amino-N-[6-[(3R,6R)-5-amino-3,6-dimethyl-6-(trifluoromethyl)-2H-1,4-oxazin-3-yl]-5-fluoro-2-pyridinyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[6-[(3R,6R)-5-amino-3,6-dimethyl-6-(trifluoromethyl)-2H-1,4-oxazin-3-yl]-5-fluoro-2-pyridinyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88602362 |
| Molecular Formula | C19H18F7N7O3 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 3-amino-N-[6-[(3R,6R)-5-amino-3,6-dimethyl-6-(trifluoromethyl)-2H-1,4-oxazin-3-yl]-5-fluoro-2-pyridinyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | C[C@@]1(c2nc(NC(=O)c3ncc(OCC(F)(F)F)nc3N)ccc2F)CO[C@@](C)(C(F)(F)F)C(N)=N1 |
| InChI | InChI=1S/C19H18F7N7O3/c1-16(6-36-17(2,15(28)33-16)19(24,25)26)12-8(20)3-4-9(30-12)31-14(34)11-13(27)32-10(5-29-11)35-7-18(21,22)23/h3-5H,6-7H2,1-2H3,(H2,27,32)(H2,28,33)(H,30,31,34)/t16-,17+/m0/s1 |
| InChIKey | FKENLPZVPNVYQW-DLBZAZTESA-N |
| XLogP | 2.71 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |