C19H23F3O3S — CID 88602741
(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene;trifluoromethanesulfonic acid (PubChem CID 88602741) has the molecular formula C19H23F3O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is (8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene;trifluoromethanesulfonic acid.
| Compound Name | (8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 88602741 |
| Molecular Formula | C19H23F3O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene;trifluoromethanesulfonic acid |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CCc3ccccc3[C@H]1CC2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C18H22.CHF3O3S/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18;2-1(3,4)8(5,6)7/h2-6,11,15-17H,7-10,12H2,1H3;(H,5,6,7)/t15-,16-,17+,18+;/m1./s1 |
| InChIKey | STJHPLIPWWOMFJ-IKXXDGBSSA-N |
| XLogP | 5.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|