C33H43FO8 — CID 88602941
methyl 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoate (PubChem CID 88602941) has the molecular formula C33H43FO8 and a molecular weight of 586.70 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoate |
|---|---|
| PubChem CID | 88602941 |
| Molecular Formula | C33H43FO8 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(E)-4-(4-fluorophenoxy)but-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)hepta-4,5-dienoate |
| SMILES | COC(=O)C(CC=C=CC[C@H]1C(=O)CC[C@@H]1/C=C/CCOc1ccc(F)cc1)(OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C33H43FO8/c1-37-32(36)33(41-30-13-5-9-23-39-30,42-31-14-6-10-24-40-31)21-7-2-3-12-28-25(15-20-29(28)35)11-4-8-22-38-27-18-16-26(34)17-19-27/h3-4,7,11,16-19,25,28,30-31H,5-6,8-10,12-15,20-24H2,1H3/b11-4+/t2?,25-,28+,30?,31?,33?/m0/s1 |
| InChIKey | DPRBUAXUAARWHH-JEXPBKHBSA-N |
| XLogP | 6.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|