C13H17F3O4 — CID 88603167
9'-methyl-7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] (PubChem CID 88603167) has the molecular formula C13H17F3O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 9'-methyl-7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane].
| Compound Name | 9'-methyl-7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
|---|---|
| PubChem CID | 88603167 |
| Molecular Formula | C13H17F3O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 9'-methyl-7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
| SMILES | CC1C2C3OC3CCC2(OCC(F)(F)F)C12OCCO2 |
| InChI | InChI=1S/C13H17F3O4/c1-7-9-10-8(20-10)2-3-11(9,19-6-12(14,15)16)13(7)17-4-5-18-13/h7-10H,2-6H2,1H3 |
| InChIKey | XLFGIIPLMFTGDI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|