C12H15F3O4 — CID 88603209
7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] (PubChem CID 88603209) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane].
| Compound Name | 7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
|---|---|
| PubChem CID | 88603209 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 7'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,8'-3-oxatricyclo[5.2.0.02,4]nonane] |
| SMILES | FC(F)(F)COC12CCC3OC3C1CC21OCCO1 |
| InChI | InChI=1S/C12H15F3O4/c13-12(14,15)6-18-10-2-1-8-9(19-8)7(10)5-11(10)16-3-4-17-11/h7-9H,1-6H2 |
| InChIKey | YXHVQDYMZVRCIR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|