About 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione
3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione (PubChem CID 88603267) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione |
| PubChem CID | 88603267 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione |
| SMILES | C#CC1(C2=CC(=O)NC2=O)C=CC=CC1 |
| InChI | InChI=1S/C12H9NO2/c1-2-12(6-4-3-5-7-12)9-8-10(14)13-11(9)15/h1,3-6,8H,7H2,(H,13,14,15) |
| InChIKey | KGLJZZYPILGGTP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione?
The IUPAC name of 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione (CID 88603267) is 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione.
What is the SMILES notation for 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione?
The canonical SMILES for 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione is C#CC1(C2=CC(=O)NC2=O)C=CC=CC1.
What is the InChIKey of 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione?
The InChIKey is KGLJZZYPILGGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c1-2-12(6-4-3-5-7-12)9-8-10(14)13-11(9)15/h1,3-6,8H,7H2,(H,13,14,15).
What are the key properties of 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione?
3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione has a molecular weight of 199.21 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethynylcyclohexa-2,4-dien-1-yl)pyrrole-2,5-dione is sourced from PubChem (CID 88603267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).