About 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate
2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate (PubChem CID 88603439) has the molecular formula C15H19NO3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate |
| PubChem CID | 88603439 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate |
| SMILES | CC(C)C(=O)OC(=O)[C@@H]1CC(Sc2ccccc2)CN1 |
| InChI | InChI=1S/C15H19NO3S/c1-10(2)14(17)19-15(18)13-8-12(9-16-13)20-11-6-4-3-5-7-11/h3-7,10,12-13,16H,8-9H2,1-2H3/t12?,13-/m0/s1 |
| InChIKey | GLAYNFJGHUQLBV-ABLWVSNPSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate?
The IUPAC name of 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate (CID 88603439) is 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate.
What is the SMILES notation for 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate?
The canonical SMILES for 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate is CC(C)C(=O)OC(=O)[C@@H]1CC(Sc2ccccc2)CN1.
What is the InChIKey of 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate?
The InChIKey is GLAYNFJGHUQLBV-ABLWVSNPSA-N. The full InChI is InChI=1S/C15H19NO3S/c1-10(2)14(17)19-15(18)13-8-12(9-16-13)20-11-6-4-3-5-7-11/h3-7,10,12-13,16H,8-9H2,1-2H3/t12?,13-/m0/s1.
What are the key properties of 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate?
2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate has a molecular weight of 293.39 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoyl (2S)-4-phenylsulfanylpyrrolidine-2-carboxylate is sourced from PubChem (CID 88603439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).