About 2-aminoethanol;N,N-dimethylformamide
2-aminoethanol;N,N-dimethylformamide (PubChem CID 88603613) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-aminoethanol;N,N-dimethylformamide.
Molecular Properties
| Compound Name | 2-aminoethanol;N,N-dimethylformamide |
| PubChem CID | 88603613 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 2-aminoethanol;N,N-dimethylformamide |
| SMILES | CN(C)C=O.NCCO |
| InChI | InChI=1S/C3H7NO.C2H7NO/c1-4(2)3-5;3-1-2-4/h3H,1-2H3;4H,1-3H2 |
| InChIKey | BRHBOBZSQSCUEU-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;N,N-dimethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;N,N-dimethylformamide?
The IUPAC name of 2-aminoethanol;N,N-dimethylformamide (CID 88603613) is 2-aminoethanol;N,N-dimethylformamide.
What is the SMILES notation for 2-aminoethanol;N,N-dimethylformamide?
The canonical SMILES for 2-aminoethanol;N,N-dimethylformamide is CN(C)C=O.NCCO.
What is the InChIKey of 2-aminoethanol;N,N-dimethylformamide?
The InChIKey is BRHBOBZSQSCUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H7NO/c1-4(2)3-5;3-1-2-4/h3H,1-2H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;N,N-dimethylformamide?
2-aminoethanol;N,N-dimethylformamide has a molecular weight of 134.18 g/mol, XLogP of -1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;N,N-dimethylformamide is sourced from PubChem (CID 88603613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).