C24H37NO7S2Si — CID 88604011
methyl (Z)-2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-methylsulfonyloxypent-2-enoate (PubChem CID 88604011) has the molecular formula C24H37NO7S2Si and a molecular weight of 543.78 g/mol. Its IUPAC name is methyl (Z)-2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-methylsulfonyloxypent-2-enoate.
| Compound Name | methyl (Z)-2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-methylsulfonyloxypent-2-enoate |
|---|---|
| PubChem CID | 88604011 |
| Molecular Formula | C24H37NO7S2Si |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | methyl (Z)-2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenylsulfanylazetidin-1-yl]-3-methylsulfonyloxypent-2-enoate |
| SMILES | CC/C(OS(C)(=O)=O)=C(\C(=O)OC)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H37NO7S2Si/c1-10-18(31-34(7,28)29)20(23(27)30-6)25-21(26)19(16(2)32-35(8,9)24(3,4)5)22(25)33-17-14-12-11-13-15-17/h11-16,19,22H,10H2,1-9H3/b20-18-/t16-,19+,22-/m1/s1 |
| InChIKey | FLPAFDMSOOVEFJ-VXTLZUJJSA-N |
| XLogP | 4.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|