About 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid
6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid (PubChem CID 88604068) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid |
| PubChem CID | 88604068 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CCC2=CC(O)C=CC2=C1 |
| InChI | InChI=1S/C10H10O4S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3-6,9,11H,2H2,(H,12,13,14) |
| InChIKey | OGQNHIGQIZGIRR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid?
The IUPAC name of 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid (CID 88604068) is 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid.
What is the SMILES notation for 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid?
The canonical SMILES for 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid is O=S(=O)(O)C1=CCC2=CC(O)C=CC2=C1.
What is the InChIKey of 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid?
The InChIKey is OGQNHIGQIZGIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1,3-6,9,11H,2H2,(H,12,13,14).
What are the key properties of 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid?
6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid has a molecular weight of 226.25 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4,6-dihydronaphthalene-2-sulfonic acid is sourced from PubChem (CID 88604068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).