C10F23N — CID 88604470
N,1,1,1,2,2,3,4,5,5,6,7,7,7-tetradecafluoro-N,4,6-tris(trifluoromethyl)heptan-3-amine (PubChem CID 88604470) has the molecular formula C10F23N and a molecular weight of 571.07 g/mol. Its IUPAC name is N,1,1,1,2,2,3,4,5,5,6,7,7,7-tetradecafluoro-N,4,6-tris(trifluoromethyl)heptan-3-amine.
| Compound Name | N,1,1,1,2,2,3,4,5,5,6,7,7,7-tetradecafluoro-N,4,6-tris(trifluoromethyl)heptan-3-amine |
|---|---|
| PubChem CID | 88604470 |
| Molecular Formula | C10F23N |
| Molecular Weight | 571.07 g/mol |
| Exact Mass | 570.97 |
| IUPAC Name | N,1,1,1,2,2,3,4,5,5,6,7,7,7-tetradecafluoro-N,4,6-tris(trifluoromethyl)heptan-3-amine |
| SMILES | FN(C(F)(F)F)C(F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10F23N/c11-1(6(18,19)20,3(13,14)2(12,7(21,22)23)8(24,25)26)5(17,34(33)10(30,31)32)4(15,16)9(27,28)29 |
| InChIKey | UKVSJQYNGFSVPJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.07 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|