C23H25N2O2+ — CID 8860463
2-(4-benzylpyridin-1-ium-1-yl)-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 8860463) has the molecular formula C23H25N2O2+ and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-(4-benzylpyridin-1-ium-1-yl)-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-benzylpyridin-1-ium-1-yl)-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8860463 |
| Molecular Formula | C23H25N2O2+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-(4-benzylpyridin-1-ium-1-yl)-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)C[n+]2ccc(Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c1-27-22-9-7-19(8-10-22)11-14-24-23(26)18-25-15-12-21(13-16-25)17-20-5-3-2-4-6-20/h2-10,12-13,15-16H,11,14,17-18H2,1H3/p+1 |
| InChIKey | QWIUFRITYSQEGK-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|