C11H12N2O6S2 — CID 88604794
2,5-diamino-3-methylnaphthalene-1,7-disulfonic acid (PubChem CID 88604794) has the molecular formula C11H12N2O6S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2,5-diamino-3-methylnaphthalene-1,7-disulfonic acid.
| Compound Name | 2,5-diamino-3-methylnaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 88604794 |
| Molecular Formula | C11H12N2O6S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2,5-diamino-3-methylnaphthalene-1,7-disulfonic acid |
| SMILES | Cc1cc2c(N)cc(S(=O)(=O)O)cc2c(S(=O)(=O)O)c1N |
| InChI | InChI=1S/C11H12N2O6S2/c1-5-2-7-8(11(10(5)13)21(17,18)19)3-6(4-9(7)12)20(14,15)16/h2-4H,12-13H2,1H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | ADHCYEQWSOBDAB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|