About [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide
[(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide (PubChem CID 88605158) has the molecular formula C6H2N6
and a molecular weight of 158.12 g/mol. Its IUPAC name is [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide.
Molecular Properties
| Compound Name | [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide |
| PubChem CID | 88605158 |
| Molecular Formula | C6H2N6 |
| Molecular Weight | 158.12 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide |
| SMILES | N#C/C(N)=C(/C#N)N(C#N)C#N |
| InChI | InChI=1S/C6H2N6/c7-1-5(11)6(2-8)12(3-9)4-10/h11H2/b6-5+ |
| InChIKey | AVAMNKWDRPHADX-AATRIKPKSA-N |
| XLogP | -0.53 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.12 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide?
The IUPAC name of [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide (CID 88605158) is [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide.
What is the SMILES notation for [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide?
The canonical SMILES for [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide is N#C/C(N)=C(/C#N)N(C#N)C#N.
What is the InChIKey of [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide?
The InChIKey is AVAMNKWDRPHADX-AATRIKPKSA-N. The full InChI is InChI=1S/C6H2N6/c7-1-5(11)6(2-8)12(3-9)4-10/h11H2/b6-5+.
What are the key properties of [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide?
[(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide has a molecular weight of 158.12 g/mol, XLogP of -0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-amino-1,2-dicyanoethenyl]-cyanocyanamide is sourced from PubChem (CID 88605158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).