C14H11NO8S — CID 88605888
1,1-dioxo-1,2-benzothiazol-3-one;3,4,5-trihydroxybenzoic acid (PubChem CID 88605888) has the molecular formula C14H11NO8S and a molecular weight of 353.31 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-one;3,4,5-trihydroxybenzoic acid.
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-one;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 88605888 |
| Molecular Formula | C14H11NO8S |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;3,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1.O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C7H5NO3S.C7H6O5/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;8-4-1-3(7(11)12)2-5(9)6(4)10/h1-4H,(H,8,9);1-2,8-10H,(H,11,12) |
| InChIKey | FQIOCPDZMFDWEW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|