About copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid
copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 88605985) has the molecular formula C24H40CuO8
and a molecular weight of 520.12 g/mol. Its IUPAC name is copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid.
Molecular Properties
| Compound Name | copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid |
| PubChem CID | 88605985 |
| Molecular Formula | C24H40CuO8 |
| Molecular Weight | 520.12 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O.[Cu] |
| InChI | InChI=1S/C24H40O8.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(27)32-22(28)19-24(31,23(29)30)18-20(25)26;/h9-10,31H,2-8,11-19H2,1H3,(H,25,26)(H,29,30);/b10-9-; |
| InChIKey | SJCVGTLVDGOCEG-KVVVOXFISA-N |
| XLogP | 4.77 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.12 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid?
The IUPAC name of copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid (CID 88605985) is copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid.
What is the SMILES notation for copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid?
The canonical SMILES for copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid is CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O.[Cu].
What is the InChIKey of copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid?
The InChIKey is SJCVGTLVDGOCEG-KVVVOXFISA-N. The full InChI is InChI=1S/C24H40O8.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(27)32-22(28)19-24(31,23(29)30)18-20(25)26;/h9-10,31H,2-8,11-19H2,1H3,(H,25,26)(H,29,30);/b10-9-;.
What are the key properties of copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid?
copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid has a molecular weight of 520.12 g/mol, XLogP of 4.77, 20 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-hydroxy-2-[2-[(Z)-octadec-9-enoyl]oxy-2-oxoethyl]butanedioic acid is sourced from PubChem (CID 88605985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).