About [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin
[(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin (PubChem CID 88606811) has the molecular formula C20H26OSn
and a molecular weight of 401.14 g/mol. Its IUPAC name is [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin.
Molecular Properties
| Compound Name | [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin |
| PubChem CID | 88606811 |
| Molecular Formula | C20H26OSn |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin |
| SMILES | C=C1/C=C/[C@H](C(C)C)CCC(=O)C([Sn]c2ccccc2)CC1 |
| InChI | InChI=1S/C14H21O.C6H5.Sn/c1-11(2)13-8-7-12(3)5-4-6-14(15)10-9-13;1-2-4-6-5-3-1;/h6-8,11,13H,3-5,9-10H2,1-2H3;1-5H;/b8-7+;;/t13-;;/m0../s1 |
| InChIKey | PXHFNJCDVPLIGB-UWDDQERWSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin?
The IUPAC name of [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin (CID 88606811) is [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin.
What is the SMILES notation for [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin?
The canonical SMILES for [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin is C=C1/C=C/[C@H](C(C)C)CCC(=O)C([Sn]c2ccccc2)CC1.
What is the InChIKey of [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin?
The InChIKey is PXHFNJCDVPLIGB-UWDDQERWSA-N. The full InChI is InChI=1S/C14H21O.C6H5.Sn/c1-11(2)13-8-7-12(3)5-4-6-14(15)10-9-13;1-2-4-6-5-3-1;/h6-8,11,13H,3-5,9-10H2,1-2H3;1-5H;/b8-7+;;/t13-;;/m0../s1.
What are the key properties of [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin?
[(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin has a molecular weight of 401.14 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(5E,7S)-4-methylidene-10-oxo-7-propan-2-ylcyclodec-5-en-1-yl]-phenyltin is sourced from PubChem (CID 88606811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).