About N,N-diethylethanamine;pentafluoro-λ5-stibane
N,N-diethylethanamine;pentafluoro-λ5-stibane (PubChem CID 88607097) has the molecular formula C6H15F5NSb
and a molecular weight of 317.94 g/mol. Its IUPAC name is N,N-diethylethanamine;pentafluoro-λ5-stibane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;pentafluoro-λ5-stibane |
| PubChem CID | 88607097 |
| Molecular Formula | C6H15F5NSb |
| Molecular Weight | 317.94 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N,N-diethylethanamine;pentafluoro-λ5-stibane |
| SMILES | CCN(CC)CC.F[Sb](F)(F)(F)F |
| InChI | InChI=1S/C6H15N.5FH.Sb/c1-4-7(5-2)6-3;;;;;;/h4-6H2,1-3H3;5*1H;/q;;;;;;+5/p-5 |
| InChIKey | QIWPYEZFHHQIEG-UHFFFAOYSA-I |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;pentafluoro-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;pentafluoro-λ5-stibane?
The IUPAC name of N,N-diethylethanamine;pentafluoro-λ5-stibane (CID 88607097) is N,N-diethylethanamine;pentafluoro-λ5-stibane.
What is the SMILES notation for N,N-diethylethanamine;pentafluoro-λ5-stibane?
The canonical SMILES for N,N-diethylethanamine;pentafluoro-λ5-stibane is CCN(CC)CC.F[Sb](F)(F)(F)F.
What is the InChIKey of N,N-diethylethanamine;pentafluoro-λ5-stibane?
The InChIKey is QIWPYEZFHHQIEG-UHFFFAOYSA-I. The full InChI is InChI=1S/C6H15N.5FH.Sb/c1-4-7(5-2)6-3;;;;;;/h4-6H2,1-3H3;5*1H;/q;;;;;;+5/p-5.
What are the key properties of N,N-diethylethanamine;pentafluoro-λ5-stibane?
N,N-diethylethanamine;pentafluoro-λ5-stibane has a molecular weight of 317.94 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;pentafluoro-λ5-stibane is sourced from PubChem (CID 88607097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).