C4H3F4+ — CID 88607904
hydron;1,1,2,3-tetrafluorobuta-1,3-diene (PubChem CID 88607904) has the molecular formula C4H3F4+ and a molecular weight of 127.06 g/mol. Its IUPAC name is hydron;1,1,2,3-tetrafluorobuta-1,3-diene.
| Compound Name | hydron;1,1,2,3-tetrafluorobuta-1,3-diene |
|---|---|
| PubChem CID | 88607904 |
| Molecular Formula | C4H3F4+ |
| Molecular Weight | 127.06 g/mol |
| Exact Mass | 127.02 |
| IUPAC Name | hydron;1,1,2,3-tetrafluorobuta-1,3-diene |
| SMILES | C=C(F)C(F)=C(F)F.[H+] |
| InChI | InChI=1S/C4H2F4/c1-2(5)3(6)4(7)8/h1H2/p+1 |
| InChIKey | NJVUNVISYDSXKR-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|