About 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid
2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid (PubChem CID 88608280) has the molecular formula C20H13N5O4S
and a molecular weight of 419.42 g/mol. Its IUPAC name is 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid |
| PubChem CID | 88608280 |
| Molecular Formula | C20H13N5O4S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid |
| SMILES | CS(=O)(=O)Nc1cccc2c(C(=O)O)c(/N=N/c3ccc(C#N)c(C#N)c3)ccc12 |
| InChI | InChI=1S/C20H13N5O4S/c1-30(28,29)25-17-4-2-3-16-15(17)7-8-18(19(16)20(26)27)24-23-14-6-5-12(10-21)13(9-14)11-22/h2-9,25H,1H3,(H,26,27)/b24-23+ |
| InChIKey | UVLSKUQQWMWSTP-WCWDXBQESA-N |
| XLogP | 4.07 |
| TPSA | 155.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid?
The IUPAC name of 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid (CID 88608280) is 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid.
What is the SMILES notation for 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid?
The canonical SMILES for 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid is CS(=O)(=O)Nc1cccc2c(C(=O)O)c(/N=N/c3ccc(C#N)c(C#N)c3)ccc12.
What is the InChIKey of 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid?
The InChIKey is UVLSKUQQWMWSTP-WCWDXBQESA-N. The full InChI is InChI=1S/C20H13N5O4S/c1-30(28,29)25-17-4-2-3-16-15(17)7-8-18(19(16)20(26)27)24-23-14-6-5-12(10-21)13(9-14)11-22/h2-9,25H,1H3,(H,26,27)/b24-23+.
What are the key properties of 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid?
2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid has a molecular weight of 419.42 g/mol, XLogP of 4.07, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dicyanophenyl)diazenyl]-5-(methanesulfonamido)naphthalene-1-carboxylic acid is sourced from PubChem (CID 88608280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).