C10H8F12I2 — CID 88608643
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-1,1-diiododecane (PubChem CID 88608643) has the molecular formula C10H8F12I2 and a molecular weight of 609.96 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-1,1-diiododecane.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-1,1-diiododecane |
|---|---|
| PubChem CID | 88608643 |
| Molecular Formula | C10H8F12I2 |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 609.85 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-1,1-diiododecane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(I)I |
| InChI | InChI=1S/C10H8F12I2/c1-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)3-2-4(23)24/h4H,2-3H2,1H3 |
| InChIKey | NSKRIDIPIQWTFU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|