About 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde
3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde (PubChem CID 88608681) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde.
Molecular Properties
| Compound Name | 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde |
| PubChem CID | 88608681 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde |
| SMILES | Nc1cccc(C=O)c1-c1ccc2c(c1)C=C2 |
| InChI | InChI=1S/C15H11NO/c16-14-3-1-2-13(9-17)15(14)12-7-5-10-4-6-11(10)8-12/h1-9H,16H2 |
| InChIKey | ARPFJUWCLUBZFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde?
The IUPAC name of 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde (CID 88608681) is 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde.
What is the SMILES notation for 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde?
The canonical SMILES for 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde is Nc1cccc(C=O)c1-c1ccc2c(c1)C=C2.
What is the InChIKey of 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde?
The InChIKey is ARPFJUWCLUBZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c16-14-3-1-2-13(9-17)15(14)12-7-5-10-4-6-11(10)8-12/h1-9H,16H2.
What are the key properties of 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde?
3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde has a molecular weight of 221.26 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)benzaldehyde is sourced from PubChem (CID 88608681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).