C18H18F2O3S — CID 88608754
[(1R,2S)-6-fluoro-2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]methanesulfonic acid (PubChem CID 88608754) has the molecular formula C18H18F2O3S and a molecular weight of 352.40 g/mol. Its IUPAC name is [(1R,2S)-6-fluoro-2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]methanesulfonic acid.
| Compound Name | [(1R,2S)-6-fluoro-2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 88608754 |
| Molecular Formula | C18H18F2O3S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [(1R,2S)-6-fluoro-2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]methanesulfonic acid |
| SMILES | C[C@]1(c2ccc(F)cc2)CCc2cc(F)ccc2[C@@H]1CS(=O)(=O)O |
| InChI | InChI=1S/C18H18F2O3S/c1-18(13-2-4-14(19)5-3-13)9-8-12-10-15(20)6-7-16(12)17(18)11-24(21,22)23/h2-7,10,17H,8-9,11H2,1H3,(H,21,22,23)/t17-,18+/m0/s1 |
| InChIKey | AUIMJUCBOMFEEH-ZWKOTPCHSA-N |
| XLogP | 3.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|