C30H66N2 — CID 88608998
N,N-diethylethanamine;6-methyl-N,N-bis(6-methylheptyl)heptan-1-amine (PubChem CID 88608998) has the molecular formula C30H66N2 and a molecular weight of 454.87 g/mol. Its IUPAC name is N,N-diethylethanamine;6-methyl-N,N-bis(6-methylheptyl)heptan-1-amine.
| Compound Name | N,N-diethylethanamine;6-methyl-N,N-bis(6-methylheptyl)heptan-1-amine |
|---|---|
| PubChem CID | 88608998 |
| Molecular Formula | C30H66N2 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.52 |
| IUPAC Name | N,N-diethylethanamine;6-methyl-N,N-bis(6-methylheptyl)heptan-1-amine |
| SMILES | CC(C)CCCCCN(CCCCCC(C)C)CCCCCC(C)C.CCN(CC)CC |
| InChI | InChI=1S/C24H51N.C6H15N/c1-22(2)16-10-7-13-19-25(20-14-8-11-17-23(3)4)21-15-9-12-18-24(5)6;1-4-7(5-2)6-3/h22-24H,7-21H2,1-6H3;4-6H2,1-3H3 |
| InChIKey | GKCYHHYKGXJTIB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|