About piperidin-2-amine;platinum;sulfuric acid
piperidin-2-amine;platinum;sulfuric acid (PubChem CID 88609183) has the molecular formula C5H14N2O4PtS
and a molecular weight of 393.32 g/mol. Its IUPAC name is piperidin-2-amine;platinum;sulfuric acid.
Molecular Properties
| Compound Name | piperidin-2-amine;platinum;sulfuric acid |
| PubChem CID | 88609183 |
| Molecular Formula | C5H14N2O4PtS |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | piperidin-2-amine;platinum;sulfuric acid |
| SMILES | NC1CCCCN1.O=S(=O)(O)O.[Pt] |
| InChI | InChI=1S/C5H12N2.H2O4S.Pt/c6-5-3-1-2-4-7-5;1-5(2,3)4;/h5,7H,1-4,6H2;(H2,1,2,3,4); |
| InChIKey | WSPVEEIQEIAZAI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze piperidin-2-amine;platinum;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-2-amine;platinum;sulfuric acid?
The IUPAC name of piperidin-2-amine;platinum;sulfuric acid (CID 88609183) is piperidin-2-amine;platinum;sulfuric acid.
What is the SMILES notation for piperidin-2-amine;platinum;sulfuric acid?
The canonical SMILES for piperidin-2-amine;platinum;sulfuric acid is NC1CCCCN1.O=S(=O)(O)O.[Pt].
What is the InChIKey of piperidin-2-amine;platinum;sulfuric acid?
The InChIKey is WSPVEEIQEIAZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.H2O4S.Pt/c6-5-3-1-2-4-7-5;1-5(2,3)4;/h5,7H,1-4,6H2;(H2,1,2,3,4);.
What are the key properties of piperidin-2-amine;platinum;sulfuric acid?
piperidin-2-amine;platinum;sulfuric acid has a molecular weight of 393.32 g/mol, XLogP of -0.61, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-2-amine;platinum;sulfuric acid is sourced from PubChem (CID 88609183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).