C10H11N5O4S2 — CID 88609307
(6R)-7,8-dioxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88609307) has the molecular formula C10H11N5O4S2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (6R)-7,8-dioxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7,8-dioxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88609307 |
| Molecular Formula | C10H11N5O4S2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (6R)-7,8-dioxo-3-[1-(2H-tetrazol-5-ylsulfanyl)ethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC(Sc1nn[nH]n1)C1(C(=O)O)CS[C@@H]2C(=O)C(=O)N2C1 |
| InChI | InChI=1S/C10H11N5O4S2/c1-4(21-9-11-13-14-12-9)10(8(18)19)2-15-6(17)5(16)7(15)20-3-10/h4,7H,2-3H2,1H3,(H,18,19)(H,11,12,13,14)/t4?,7-,10?/m1/s1 |
| InChIKey | JSCCVMTWNLNEPW-POUYQYJTSA-N |
| XLogP | -0.76 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|